Products 54273-31-3
CAS 54273-31-3 is the registry number for 4-((4-(Dimethylamino)phenyl)ethynyl)benzonitrile, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 50mg, 100mg.
4-[2-[4-(dimethylamino)phenyl]ethynyl]benzonitrile (CAS 54273-31-3) is a chemical compound with the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. IUPAC name: 4-[2-[4-(dimethylamino)phenyl]ethynyl]benzonitrile. InChIKey: PKGAADLJOBZPQS-UHFFFAOYSA-N.
| Molecular formula | C17H14N2 |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | 4-[2-[4-(dimethylamino)phenyl]ethynyl]benzonitrile |
| InChIKey | PKGAADLJOBZPQS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)