CAS 5428-02-4 is the registry number for 2-Nitro-2-phenylpropane-1,3-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-nitro-2-phenylpropane-1,3-diol (CAS 5428-02-4) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-nitro-2-phenylpropane-1,3-diol. InChIKey: AJRYCRIQZBMNEO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-nitro-2-phenylpropane-1,3-diol |
| InChIKey | AJRYCRIQZBMNEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CO)(CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)