Products 54299-52-4
CAS 54299-52-4 is the registry number for 1-(2,4-Dihydroxy-3,6-dimethoxyphenyl)-3-phenylpropan-1-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenylpropan-1-one (CAS 54299-52-4) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: 1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenylpropan-1-one. InChIKey: FXSMSBHKHZUDMO-UHFFFAOYSA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | 1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenylpropan-1-one |
| InChIKey | FXSMSBHKHZUDMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)O)OC)O)C(=O)CCC2=CC=CC=C2 |
Computed by PubChem (NCBI)