CAS 54322-10-0 appears in our catalog under these names: 1,5-Pentanedioic acid monobenzyl ester, 1,5-Pentanedioic acid monobenzyl ester 97%, 5-(Benzyloxy)-5-oxopentanoic Acid, 97%, 97%, 1,5-Pentanedioic acid monobenzyl ester, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g, 500g, 50g.
5-oxo-5-phenylmethoxypentanoic acid (CAS 54322-10-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 5-oxo-5-phenylmethoxypentanoic acid. InChIKey: WRSDJJXJDSEUSQ-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | WRSDJJXJDSEUSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)