Products 5436-46-4
CAS 5436-46-4 appears in our catalog under these names: Sempervirine nitrate, Benz[g]indolo[2,3-a]quinolizine, 1,2,3,4-tetrahydro-, mononitrate, ≥96%. Offered by: Biosynth, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg.
Nitric acid;16,17,18,19-tetrahydroyohimban (CAS 5436-46-4) is a chemical compound with the molecular formula C19H17N3O3 and a molecular weight of 335.4 g/mol. IUPAC name: nitric acid;16,17,18,19-tetrahydroyohimban. InChIKey: IECUCQNAZVURGY-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | nitric acid;16,17,18,19-tetrahydroyohimban |
| InChIKey | IECUCQNAZVURGY-UHFFFAOYSA-N |
| SMILES | C1CCC2=CN3C=CC4=C5C=CC=CC5=NC4=C3C=C2C1.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)