CAS 54375-49-4 is the registry number for 1-(3-Nitro-4-propoxyphenyl)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(3-nitro-4-propoxyphenyl)ethanone (CAS 54375-49-4) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 1-(3-nitro-4-propoxyphenyl)ethanone. InChIKey: QTEMPZVBRCDQBD-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1-(3-nitro-4-propoxyphenyl)ethanone |
| InChIKey | QTEMPZVBRCDQBD-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)