Products 543910-44-7
CAS 543910-44-7 appears in our catalog under these names: (3aS,4R,7aS)-tert-butyl 4-acetoxyoctahydro-1H-indole-1-carboxylate, 95%, 95%, 1H-Indole-1-carboxylic acid, 4-(acetyloxy)octahydro-, 1,1-dimethylethyl ester, (3aS,4R,7aS)-, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3aS,4R,7aS)-4-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (CAS 543910-44-7) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: tert-butyl (3aS,4R,7aS)-4-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate. InChIKey: XAQGVQBGKDMCCK-RWMBFGLXSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | tert-butyl (3aS,4R,7aS)-4-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| InChIKey | XAQGVQBGKDMCCK-RWMBFGLXSA-N |
| SMILES | CC(=O)O[C@@H]1CCC[C@H]2[C@@H]1CCN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)