CAS 54397-23-8 appears in our catalog under these names: Amoxicillin Impurity 1, Amoxicillin Impurity 24, D-p-Hydroxyphenylglycinamide (>85%), (2R)-2-Amino-2-(4-hydroxyphenyl)acetamide. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 25mg, 100mg.
(2R)-2-amino-2-(4-hydroxyphenyl)acetamide (CAS 54397-23-8) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: (2R)-2-amino-2-(4-hydroxyphenyl)acetamide. InChIKey: WQFROZWIRZWMFE-SSDOTTSWSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-hydroxyphenyl)acetamide |
| InChIKey | WQFROZWIRZWMFE-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)N)N)O |
Computed by PubChem (NCBI)