CAS 54406-48-3 appears in our catalog under these names: Empenthrin (Vaporthrin), Empenthrin, Empenthrin, Concentration: 100 µg/ml Solvent: Acetonitrile, Empenthrin, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards, MedChemExpress. Available pack sizes: on request, 250mg, 100mg, 1x5ml, Get quote.
4-methylhept-4-en-1-yn-3-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 54406-48-3) is a chemical compound with the molecular formula C18H26O2 and a molecular weight of 274.4 g/mol. IUPAC name: 4-methylhept-4-en-1-yn-3-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: YUGWDVYLFSETPE-UHFFFAOYSA-N.
| Molecular formula | C18H26O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-methylhept-4-en-1-yn-3-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | YUGWDVYLFSETPE-UHFFFAOYSA-N |
| SMILES | CCC=C(C)C(C#C)OC(=O)C1C(C1(C)C)C=C(C)C |
Computed by PubChem (NCBI)