CAS 946845-14-3 is the registry number for rac Galaxolidone Lactol. Offered by: TRC. Available pack sizes: 100mg.
4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromen-1-ol (CAS 946845-14-3) is a chemical compound with the molecular formula C18H26O2 and a molecular weight of 274.4 g/mol. IUPAC name: 4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromen-1-ol. InChIKey: QAPQORLXRUPNGA-UHFFFAOYSA-N.
| Molecular formula | C18H26O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4,6,6,7,8,8-hexamethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromen-1-ol |
| InChIKey | QAPQORLXRUPNGA-UHFFFAOYSA-N |
| SMILES | CC1COC(C2=CC3=C(C=C12)C(C(C3(C)C)C)(C)C)O |
Computed by PubChem (NCBI)