CAS 5443-31-2 appears in our catalog under these names: 2-Methylquinoline-4,6-diamine, 2-Methylquinoline-4,6-diamine, 96%, 4,6–DIAMINO–2–METHYL–QUINOLINE, 2-methylquinoline-4,6-diamine, >95% (HPLC). Offered by: Biosynth, AmBeed, GLPBio, TRC. Available pack sizes: 250mg, 2,5g, 5g, 1g, 10g, 100mg, 10mg, 50mg.
2-methylquinoline-4,6-diamine (CAS 5443-31-2) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-methylquinoline-4,6-diamine. InChIKey: XKDPIURMGBVXAB-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-methylquinoline-4,6-diamine |
| InChIKey | XKDPIURMGBVXAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)N)N |
Computed by PubChem (NCBI)