CAS 544684-93-7 appears in our catalog under these names: Rofecoxib-d5, Vioxx-d5 (Major), >95% (HPLC), Rofecoxib–d5, Vioxx-d5 (major). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 5mg, 25mg, 50mg, 500 μg.
3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one (CAS 544684-93-7) is a chemical compound with the molecular formula C17H14O4S and a molecular weight of 319.4 g/mol. IUPAC name: 3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one. InChIKey: RZJQGNCSTQAWON-VIQYUKPQSA-N.
| Molecular formula | C17H14O4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-(4-methylsulfonylphenyl)-4-(2,3,4,5,6-pentadeuteriophenyl)-2H-furan-5-one |
| InChIKey | RZJQGNCSTQAWON-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(COC2=O)C3=CC=C(C=C3)S(=O)(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)