Products 544686-18-2
CAS 544686-18-2 appears in our catalog under these names: Celecoxib-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, Celecoxib–d3, Celecoxib-d3, 99.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 5mg, 5 mg, 1 mg.
4-[5-[4-(trideuteriomethyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CAS 544686-18-2) is a chemical compound with the molecular formula C17H14F3N3O2S and a molecular weight of 384.4 g/mol. IUPAC name: 4-[5-[4-(trideuteriomethyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: RZEKVGVHFLEQIL-FIBGUPNXSA-N.
| Molecular formula | C17H14F3N3O2S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 4-[5-[4-(trideuteriomethyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | RZEKVGVHFLEQIL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)