CAS 544686-20-6 appears in our catalog under these names: Celecoxib-d4, >95% (HPLC), Celecoxib-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
2,3,5,6-tetradeuterio-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CAS 544686-20-6) is a chemical compound with the molecular formula C17H14F3N3O2S and a molecular weight of 385.4 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: RZEKVGVHFLEQIL-YKVCKAMESA-N.
| Molecular formula | C17H14F3N3O2S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | RZEKVGVHFLEQIL-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2C(=CC(=N2)C(F)(F)F)C3=CC=C(C=C3)C)[2H])[2H])S(=O)(=O)N)[2H] |
Computed by PubChem (NCBI)