CAS 54518-92-2 appears in our catalog under these names: H–Leu–CMK·HCl, H-Leu-CMK HCl 97%, H-Leu-CMK.HCl, 97%, 97%, (S)-3-Amino-1-chloro-5-methylhexan-2-one hydrochloride, (S)-3-Amino-1-chloro-5-methylhexan-2-one hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, Get quote.
(3S)-3-amino-1-chloro-5-methylhexan-2-one;hydrochloride (CAS 54518-92-2) is a chemical compound with the molecular formula C7H15Cl2NO and a molecular weight of 200.10 g/mol. IUPAC name: (3S)-3-amino-1-chloro-5-methylhexan-2-one;hydrochloride. InChIKey: DRZZRBOLWKRHPF-RGMNGODLSA-N.
| Molecular formula | C7H15Cl2NO |
|---|---|
| Molecular weight | 200.10 g/mol |
| IUPAC name | (3S)-3-amino-1-chloro-5-methylhexan-2-one;hydrochloride |
| InChIKey | DRZZRBOLWKRHPF-RGMNGODLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)CCl)N.Cl |
Computed by PubChem (NCBI)