CAS 59079-44-6 appears in our catalog under these names: (3S,4S)–3–Amino–1–chloro–4–methylhexan–2–one hydrochloride, H-Ile-CMK·HCl 96%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g.
(3S,4S)-3-amino-1-chloro-4-methylhexan-2-one;hydrochloride (CAS 59079-44-6) is a chemical compound with the molecular formula C7H15Cl2NO and a molecular weight of 200.10 g/mol. IUPAC name: (3S,4S)-3-amino-1-chloro-4-methylhexan-2-one;hydrochloride. InChIKey: YAWFAOTZMQRKFE-KQBMADMWSA-N.
| Molecular formula | C7H15Cl2NO |
|---|---|
| Molecular weight | 200.10 g/mol |
| IUPAC name | (3S,4S)-3-amino-1-chloro-4-methylhexan-2-one;hydrochloride |
| InChIKey | YAWFAOTZMQRKFE-KQBMADMWSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)CCl)N.Cl |
Computed by PubChem (NCBI)