Products 545349-11-9

CAS 545349-11-9 is the registry number for 4-(Cycloheptylamino)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(cycloheptylamino)-4-oxobutanoic acid (CAS 545349-11-9) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: 4-(cycloheptylamino)-4-oxobutanoic acid. InChIKey: XSJLCCURWNGWTP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO3
Molecular weight213.27 g/mol
IUPAC name4-(cycloheptylamino)-4-oxobutanoic acid
InChIKeyXSJLCCURWNGWTP-UHFFFAOYSA-N
SMILESC1CCCC(CC1)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)