CAS 54535-00-1 appears in our catalog under these names: (5,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol, 95%, (5,7–Dimethyl–(1,2,4)triazolo(1,5–a)pyrimidin–2–yl)methanol. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 5g.
(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol (CAS 54535-00-1) is a chemical compound with the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. IUPAC name: (5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol. InChIKey: SHYHYVCNCNAWHV-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol |
| InChIKey | SHYHYVCNCNAWHV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)CO)C |
Computed by PubChem (NCBI)