CAS 877471-64-2 is the registry number for 1,7-Diamino-5-Methyl-1H-Indazol-4-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1,7-diamino-5-methylindazol-4-ol (CAS 877471-64-2) is a chemical compound with the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. IUPAC name: 1,7-diamino-5-methylindazol-4-ol. InChIKey: DJJOGEVLTXQTHU-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 1,7-diamino-5-methylindazol-4-ol |
| InChIKey | DJJOGEVLTXQTHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1O)C=NN2N)N |
Computed by PubChem (NCBI)