CAS 54536-37-7 is the registry number for (S)-2-Amino-3-(benzylthio)-3-methylbutanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid (CAS 54536-37-7) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: (2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid. InChIKey: YPZAXRYHYTVHPA-JTQLQIEISA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | (2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid |
| InChIKey | YPZAXRYHYTVHPA-JTQLQIEISA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SCC1=CC=CC=C1 |
Computed by PubChem (NCBI)