CAS 54536-38-8 is the registry number for S-Benzyl-d-penicillamine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid (CAS 54536-38-8) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: (2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid. InChIKey: YPZAXRYHYTVHPA-JTQLQIEISA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | (2S)-2-amino-3-benzylsulfanyl-3-methylbutanoic acid |
| InChIKey | YPZAXRYHYTVHPA-JTQLQIEISA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SCC1=CC=CC=C1 |
Computed by PubChem (NCBI)