Products 54549-24-5

CAS 54549-24-5 is the registry number for Hexyl D-glucopyranoside, 75% in water, 75% in water. Offered by: Chemat. Available pack sizes: 100g, 500g.

Structural formula: {0} (CAS {1})

(3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 54549-24-5) is a chemical compound with the molecular formula C12H24O6 and a molecular weight of 264.31 g/mol. IUPAC name: (3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: JVAZJLFFSJARQM-OZRWLHRGSA-N.

Identity
Molecular formulaC12H24O6
Molecular weight264.31 g/mol
IUPAC name(3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol
InChIKeyJVAZJLFFSJARQM-OZRWLHRGSA-N
SMILESCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O

Computed by PubChem (NCBI)