CAS 54549-24-5 is the registry number for Hexyl D-glucopyranoside, 75% in water, 75% in water. Offered by: Chemat. Available pack sizes: 100g, 500g.
(3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 54549-24-5) is a chemical compound with the molecular formula C12H24O6 and a molecular weight of 264.31 g/mol. IUPAC name: (3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: JVAZJLFFSJARQM-OZRWLHRGSA-N.
| Molecular formula | C12H24O6 |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | (3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | JVAZJLFFSJARQM-OZRWLHRGSA-N |
| SMILES | CCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)