CAS 59080-45-4 appears in our catalog under these names: Hexyl beta-d-glucopyranoside, 98%, Hexyl β–D–glucopyranoside, Hexyl beta-D-glucopyranoside, >98.0%(GC), Hexyl β-D-glucopyranoside, Hexyl b-D-glucopyranoside. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg, 2000mg, 1000mg, 100mg, 500mg.
(2R,3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 59080-45-4) is a chemical compound with the molecular formula C12H24O6 and a molecular weight of 264.31 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: JVAZJLFFSJARQM-RMPHRYRLSA-N.
| Molecular formula | C12H24O6 |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | JVAZJLFFSJARQM-RMPHRYRLSA-N |
| SMILES | CCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)