CAS 54576-19-1 is the registry number for 6,7-Dimethoxy-1,4-dihydro-1,4-methanonaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (CAS 54576-19-1) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: 4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene. InChIKey: XFMOBKFFLFKISO-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| InChIKey | XFMOBKFFLFKISO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C3CC(C2=C1)C=C3)OC |
Computed by PubChem (NCBI)