CAS 5458-32-2 is the registry number for 2-(4-Isopropylphenyl)-4,5-dimethyl-1,3-dioxolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dimethyl-2-(4-propan-2-ylphenyl)-1,3-dioxolane (CAS 5458-32-2) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 4,5-dimethyl-2-(4-propan-2-ylphenyl)-1,3-dioxolane. InChIKey: QTHHOQBCLLTLSZ-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 4,5-dimethyl-2-(4-propan-2-ylphenyl)-1,3-dioxolane |
| InChIKey | QTHHOQBCLLTLSZ-UHFFFAOYSA-N |
| SMILES | CC1C(OC(O1)C2=CC=C(C=C2)C(C)C)C |
Computed by PubChem (NCBI)