CAS 54582-90-0 is the registry number for 4-Chloro-3,5-dimethyl-2-nitrophenol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,5-dimethyl-2-nitrophenol (CAS 54582-90-0) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 4-chloro-3,5-dimethyl-2-nitrophenol. InChIKey: YOTFJCRTPIJJFX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-chloro-3,5-dimethyl-2-nitrophenol |
| InChIKey | YOTFJCRTPIJJFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)C)[N+](=O)[O-])O |
Computed by PubChem (NCBI)