CAS 54593-31-6 appears in our catalog under these names: Ritalinic Acid Lactam, DL-threo-Ritalinic Acid Lactam(Mixture of Diastereomers), DL-threo-ritalinic acid lactam. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 1mg, 10mg, 25mg.
2-(6-oxopiperidin-2-yl)-2-phenylacetic acid (CAS 54593-31-6) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 2-(6-oxopiperidin-2-yl)-2-phenylacetic acid. InChIKey: YMVXGJVBWQZTTL-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2-(6-oxopiperidin-2-yl)-2-phenylacetic acid |
| InChIKey | YMVXGJVBWQZTTL-UHFFFAOYSA-N |
| SMILES | C1CC(NC(=O)C1)C(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)