Products 54610-49-0

CAS 54610-49-0 is the registry number for Methyl thiophene-2-carboximidate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

Methyl thiophene-2-carboximidate;hydrochloride (CAS 54610-49-0) is a chemical compound with the molecular formula C6H8ClNOS and a molecular weight of 177.65 g/mol. IUPAC name: methyl thiophene-2-carboximidate;hydrochloride. InChIKey: OEUWBJFZEJDNAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNOS
Molecular weight177.65 g/mol
IUPAC namemethyl thiophene-2-carboximidate;hydrochloride
InChIKeyOEUWBJFZEJDNAJ-UHFFFAOYSA-N
SMILESCOC(=N)C1=CC=CS1.Cl

Computed by PubChem (NCBI)