Products 72579-01-2

CAS 72579-01-2 appears in our catalog under these names: Clomethiazolum Impurity 1, Clomethiazole Impurity 1. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.

Structural formula: {0} (CAS {1})

2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol (CAS 72579-01-2) is a chemical compound with the molecular formula C6H8ClNOS and a molecular weight of 177.65 g/mol. IUPAC name: 2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol. InChIKey: OOKATFCTRGAPQX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNOS
Molecular weight177.65 g/mol
IUPAC name2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol
InChIKeyOOKATFCTRGAPQX-UHFFFAOYSA-N
SMILESCC1=C(SC=N1)C(CCl)O

Computed by PubChem (NCBI)