Products 54640-82-3
CAS 54640-82-3 appears in our catalog under these names: POLY(2-ACRYLAMIDO-2-METHYL-1-PROPANE- &, 2-Acrylamido-2-methylpropanesulfonic acid-acrylonitrile copolymer. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 10G, 1g, 5g.
2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;prop-2-enenitrile (CAS 54640-82-3) is a chemical compound with the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. IUPAC name: 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;prop-2-enenitrile. InChIKey: WXTSVBZXMYPBLC-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O4S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid;prop-2-enenitrile |
| InChIKey | WXTSVBZXMYPBLC-UHFFFAOYSA-N |
| SMILES | CC(C)(CS(=O)(=O)O)NC(=O)C=C.C=CC#N |
Computed by PubChem (NCBI)