CAS 54641-19-9 is the registry number for (S)-2-Hydroxy-3-methylbutyric Acid Sodium Salt. Offered by: TRC. Available pack sizes: 1g.
Sodium (2S)-2-hydroxy-3-methylbutanoate (CAS 54641-19-9) is a chemical compound with the molecular formula C5H9NaO3 and a molecular weight of 140.11 g/mol. IUPAC name: sodium (2S)-2-hydroxy-3-methylbutanoate. InChIKey: CPGHJLCKGBLVMB-WCCKRBBISA-M.
| Molecular formula | C5H9NaO3 |
|---|---|
| Molecular weight | 140.11 g/mol |
| IUPAC name | sodium (2S)-2-hydroxy-3-methylbutanoate |
| InChIKey | CPGHJLCKGBLVMB-WCCKRBBISA-M |
| SMILES | CC(C)[C@@H](C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)