CAS 66767-64-4 is the registry number for (2S,3S)-3-Hydroxy-2-methylbutanoic Sodium Salt. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
Sodium (2S,3S)-3-hydroxy-2-methylbutanoate (CAS 66767-64-4) is a chemical compound with the molecular formula C5H9NaO3 and a molecular weight of 140.11 g/mol. IUPAC name: sodium (2S,3S)-3-hydroxy-2-methylbutanoate. InChIKey: BZODCVQUCJISES-MMALYQPHSA-M.
| Molecular formula | C5H9NaO3 |
|---|---|
| Molecular weight | 140.11 g/mol |
| IUPAC name | sodium (2S,3S)-3-hydroxy-2-methylbutanoate |
| InChIKey | BZODCVQUCJISES-MMALYQPHSA-M |
| SMILES | C[C@@H]([C@H](C)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)