Products 54647-08-4

CAS 54647-08-4 appears in our catalog under these names: 4-Hydroxy Derricin, Derricin Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 54647-08-4) is a chemical compound with the molecular formula C21H22O4 and a molecular weight of 338.4 g/mol. IUPAC name: 1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: XDKYBPGIBVMHHB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H22O4
Molecular weight338.4 g/mol
IUPAC name1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one
InChIKeyXDKYBPGIBVMHHB-UHFFFAOYSA-N
SMILESCC(=CCC1=C(C=CC(=C1O)C(=O)C=CC2=CC=C(C=C2)O)OC)C

Computed by PubChem (NCBI)