Products 2408841-19-8
CAS 2408841-19-8 appears in our catalog under these names: PKM2–IN–3, PKM2-IN-3, 99.44%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM/1mL, 10 mg, 100 mg, 25 mg, 5 mg.
(4E)-4-[(4-ethylphenyl)methylidene]-6,8-dimethoxy-2,3-dihydro-1-benzoxepin-5-one (CAS 2408841-19-8) is a chemical compound with the molecular formula C21H22O4 and a molecular weight of 338.4 g/mol. IUPAC name: (4E)-4-[(4-ethylphenyl)methylidene]-6,8-dimethoxy-2,3-dihydro-1-benzoxepin-5-one. InChIKey: BQNYBXFXLMWECE-LFIBNONCSA-N.
| Molecular formula | C21H22O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (4E)-4-[(4-ethylphenyl)methylidene]-6,8-dimethoxy-2,3-dihydro-1-benzoxepin-5-one |
| InChIKey | BQNYBXFXLMWECE-LFIBNONCSA-N |
| SMILES | CCC1=CC=C(C=C1)/C=C/2\CCOC3=C(C2=O)C(=CC(=C3)OC)OC |
Computed by PubChem (NCBI)