Products 161099-42-9
CAS 161099-42-9 appears in our catalog under these names: Bidwillol A, Bidwillol A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-2H-chromen-7-ol (CAS 161099-42-9) is a chemical compound with the molecular formula C21H22O4 and a molecular weight of 338.4 g/mol. IUPAC name: 3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-2H-chromen-7-ol. InChIKey: CBCNITCGKSLSCT-UHFFFAOYSA-N.
| Molecular formula | C21H22O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-enyl)phenyl]-2H-chromen-7-ol |
| InChIKey | CBCNITCGKSLSCT-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1OC)C2=CC3=C(C=C(C=C3)O)OC2)O)C |
Computed by PubChem (NCBI)