CAS 54754-58-4 appears in our catalog under these names: 2-(5-Pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline, 95%, 2-(5-(Pyridin-4-yl)-1,3,4-oxadiazol-2-yl)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline (CAS 54754-58-4) is a chemical compound with the molecular formula C13H10N4O and a molecular weight of 238.24 g/mol. IUPAC name: 2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: UZFZCILKWNQMBU-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | UZFZCILKWNQMBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(O2)C3=CC=NC=C3)N |
Computed by PubChem (NCBI)