CAS 913830-25-8 is the registry number for 3-(3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline (CAS 913830-25-8) is a chemical compound with the molecular formula C13H10N4O and a molecular weight of 238.24 g/mol. IUPAC name: 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: NLDUIBYQNUWQSZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | NLDUIBYQNUWQSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC(=NO2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)