CAS 54773-19-2 appears in our catalog under these names: 2,3–Dichlorobenzotrifluoride, 1,2-Dichloro-3-(trifluoromethyl)benzene 98%, 2,3-Dichlorobenzotrifluoride, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 500g, 1g, 5g, 10g, 25g, 1000g, 1kg.
1,2-dichloro-3-(trifluoromethyl)benzene (CAS 54773-19-2) is a chemical compound with the molecular formula C7H3Cl2F3 and a molecular weight of 215.00 g/mol. IUPAC name: 1,2-dichloro-3-(trifluoromethyl)benzene. InChIKey: BJYHBJUWZMHGGQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3 |
|---|---|
| Molecular weight | 215.00 g/mol |
| IUPAC name | 1,2-dichloro-3-(trifluoromethyl)benzene |
| InChIKey | BJYHBJUWZMHGGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)