CAS 54773-20-5 appears in our catalog under these names: 1,3-Dichloro-5-(trifluoromethyl)benzene 97%, 3,5–Dichlorobenzotrifluoride, 3,5-Dichlorobenzotrifluoride, 97%. Offered by: Ambeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g.
1,3-dichloro-5-(trifluoromethyl)benzene (CAS 54773-20-5) is a chemical compound with the molecular formula C7H3Cl2F3 and a molecular weight of 215.00 g/mol. IUPAC name: 1,3-dichloro-5-(trifluoromethyl)benzene. InChIKey: PCMPDUPKYRRIIP-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3 |
|---|---|
| Molecular weight | 215.00 g/mol |
| IUPAC name | 1,3-dichloro-5-(trifluoromethyl)benzene |
| InChIKey | PCMPDUPKYRRIIP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)