CAS 54779-81-6 is the registry number for 4-Methylacetophenone Phenylhydrazone. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
N-[(E)-1-(4-methylphenyl)ethylideneamino]aniline (CAS 54779-81-6) is a chemical compound with the molecular formula C15H16N2 and a molecular weight of 224.30 g/mol. IUPAC name: N-[(E)-1-(4-methylphenyl)ethylideneamino]aniline. InChIKey: MHDFJQMQUMBFQO-DTQAZKPQSA-N.
| Molecular formula | C15H16N2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | N-[(E)-1-(4-methylphenyl)ethylideneamino]aniline |
| InChIKey | MHDFJQMQUMBFQO-DTQAZKPQSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=N/NC2=CC=CC=C2)/C |
Computed by PubChem (NCBI)