CAS 54840-57-2 is the registry number for Diethyl Methyl-d3-malonate. Offered by: TRC. Available pack sizes: 500mg, 50mg.
Diethyl 2-(trideuteriomethyl)propanedioate (CAS 54840-57-2) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 177.21 g/mol. IUPAC name: diethyl 2-(trideuteriomethyl)propanedioate. InChIKey: UPQZOUHVTJNGFK-HPRDVNIFSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 177.21 g/mol |
| IUPAC name | diethyl 2-(trideuteriomethyl)propanedioate |
| InChIKey | UPQZOUHVTJNGFK-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)