Products 54840-57-2

CAS 54840-57-2 is the registry number for Diethyl Methyl-d3-malonate. Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(trideuteriomethyl)propanedioate (CAS 54840-57-2) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 177.21 g/mol. IUPAC name: diethyl 2-(trideuteriomethyl)propanedioate. InChIKey: UPQZOUHVTJNGFK-HPRDVNIFSA-N.

Identity
Molecular formulaC8H14O4
Molecular weight177.21 g/mol
IUPAC namediethyl 2-(trideuteriomethyl)propanedioate
InChIKeyUPQZOUHVTJNGFK-HPRDVNIFSA-N
SMILES[2H]C([2H])([2H])C(C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)