Products 54916-65-3
CAS 54916-65-3 appears in our catalog under these names: 5-Chloro-2-methoxynicotinic acid, 98%, 5–Chloro–2–methoxynicotinic acid, 5-Chloro-2-methoxynicotinic acid, 5-Chloro-2-methoxynicotinic acid 98%, 5-Chloro-2-methoxynicotinic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100g, 25g, 10g, 250mg.
5-chloro-2-methoxypyridine-3-carboxylic acid (CAS 54916-65-3) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-2-methoxypyridine-3-carboxylic acid. InChIKey: DPIJNAABZCWXFD-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-2-methoxypyridine-3-carboxylic acid |
| InChIKey | DPIJNAABZCWXFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)