CAS 54995-57-2 is the registry number for 2-(3-Iodophenyl)-1,3-benzoxazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-iodophenyl)-1,3-benzoxazol-5-amine (CAS 54995-57-2) is a chemical compound with the molecular formula C13H9IN2O and a molecular weight of 336.13 g/mol. IUPAC name: 2-(3-iodophenyl)-1,3-benzoxazol-5-amine. InChIKey: NXDIGEICTIBJTM-UHFFFAOYSA-N.
| Molecular formula | C13H9IN2O |
|---|---|
| Molecular weight | 336.13 g/mol |
| IUPAC name | 2-(3-iodophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | NXDIGEICTIBJTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)