CAS 69657-66-5 is the registry number for 2-(3-Iodophenyl)benzo[d]oxazol-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-iodophenyl)-1,3-benzoxazol-6-amine (CAS 69657-66-5) is a chemical compound with the molecular formula C13H9IN2O and a molecular weight of 336.13 g/mol. IUPAC name: 2-(3-iodophenyl)-1,3-benzoxazol-6-amine. InChIKey: LFMSUHYHVXMDDK-UHFFFAOYSA-N.
| Molecular formula | C13H9IN2O |
|---|---|
| Molecular weight | 336.13 g/mol |
| IUPAC name | 2-(3-iodophenyl)-1,3-benzoxazol-6-amine |
| InChIKey | LFMSUHYHVXMDDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)C2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)