Products 55008-18-9
CAS 55008-18-9 is the registry number for methyl 3-amino-2-hydroxy-5-methoxybenzenecarboxylate, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-amino-2-hydroxy-5-methoxybenzoate (CAS 55008-18-9) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: methyl 3-amino-2-hydroxy-5-methoxybenzoate. InChIKey: NTVKQJJOZHOPBI-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | methyl 3-amino-2-hydroxy-5-methoxybenzoate |
| InChIKey | NTVKQJJOZHOPBI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)N)O)C(=O)OC |
Computed by PubChem (NCBI)