Products 5504-65-4
CAS 5504-65-4 appears in our catalog under these names: 3-Phenyl-1H-pyrazole-4-carboxylic acid, 5-Phenyl-1h-pyrazole-4-carboxylic acid, 96%, 3-Phenyl-1h-pyrazole-4-carboxylic acid, 95%, 3-Phenyl-1H-pyrazole-4-carboxylic acid, 98+%, 5-Phenyl-1H-pyrazole-4-carboxylic acid, 97% . Offered by: Fluorochem, Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-phenyl-1H-pyrazole-4-carboxylic acid (CAS 5504-65-4) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 5-phenyl-1H-pyrazole-4-carboxylic acid. InChIKey: LGTJKUYVFSBOMC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5-phenyl-1H-pyrazole-4-carboxylic acid |
| InChIKey | LGTJKUYVFSBOMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NN2)C(=O)O |
Computed by PubChem (NCBI)