CAS 55083-91-5 is the registry number for 2-amino-1-(1-aza-4-phenylbuta-1,3-dienyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-[[(E)-3-phenylprop-2-enylidene]amino]but-2-enedinitrile (CAS 55083-91-5) is a chemical compound with the molecular formula C13H10N4 and a molecular weight of 222.24 g/mol. IUPAC name: (Z)-2-amino-3-[[(E)-3-phenylprop-2-enylidene]amino]but-2-enedinitrile. InChIKey: XOWPPFGMBUWMBZ-KOQYUOLUSA-N.
| Molecular formula | C13H10N4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (Z)-2-amino-3-[[(E)-3-phenylprop-2-enylidene]amino]but-2-enedinitrile |
| InChIKey | XOWPPFGMBUWMBZ-KOQYUOLUSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)