CAS 887571-50-8 appears in our catalog under these names: 7-(4-Methylphenyl)pteridine, 95%, 7-(4-Methylphenyl)pteridine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
7-(4-methylphenyl)pteridine (CAS 887571-50-8) is a chemical compound with the molecular formula C13H10N4 and a molecular weight of 222.24 g/mol. IUPAC name: 7-(4-methylphenyl)pteridine. InChIKey: WIKGOJPAYOWLOB-UHFFFAOYSA-N.
| Molecular formula | C13H10N4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 7-(4-methylphenyl)pteridine |
| InChIKey | WIKGOJPAYOWLOB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=NC=NC=C3N=C2 |
Computed by PubChem (NCBI)