Products 5518-09-2
CAS 5518-09-2 appears in our catalog under these names: 2-(Naphthalen-1-yl)malononitrile, 1-Naphthylmalononitrile, 95%, 1-Naphthylmalononitrile, >95.0%(HPLC), 1-Naphthylmalononitrile, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, TCI, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-naphthalen-1-ylpropanedinitrile (CAS 5518-09-2) is a chemical compound with the molecular formula C13H8N2 and a molecular weight of 192.22 g/mol. IUPAC name: 2-naphthalen-1-ylpropanedinitrile. InChIKey: JSYNLGSYUCZAGV-UHFFFAOYSA-N.
| Molecular formula | C13H8N2 |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 2-naphthalen-1-ylpropanedinitrile |
| InChIKey | JSYNLGSYUCZAGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C#N)C#N |
Computed by PubChem (NCBI)