CAS 57102-93-9 appears in our catalog under these names: 9H-Carbazole-3-carbonitrile 95%, 9H-Carbazole-3-Carbonitrile, 98%, 98%, 9H-Carbazole-3-carbonitrile, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 50g, 100g.
9H-carbazole-3-carbonitrile (CAS 57102-93-9) is a chemical compound with the molecular formula C13H8N2 and a molecular weight of 192.22 g/mol. IUPAC name: 9H-carbazole-3-carbonitrile. InChIKey: APYLNYCULQUSLG-UHFFFAOYSA-N.
| Molecular formula | C13H8N2 |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 9H-carbazole-3-carbonitrile |
| InChIKey | APYLNYCULQUSLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)C#N |
Computed by PubChem (NCBI)